C9H15NO — CID 123223171
4-penta-1,3-dien-2-ylmorpholine (PubChem CID 123223171) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-penta-1,3-dien-2-ylmorpholine.
| Compound Name | 4-penta-1,3-dien-2-ylmorpholine |
|---|---|
| PubChem CID | 123223171 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-penta-1,3-dien-2-ylmorpholine |
| SMILES | C=C(C=CC)N1CCOCC1 |
| InChI | InChI=1S/C9H15NO/c1-3-4-9(2)10-5-7-11-8-6-10/h3-4H,2,5-8H2,1H3 |
| InChIKey | JXNYDXCZYMYISI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|