C11H19NO — CID 90845057
4-(5-methylhexa-2,4-dien-3-yl)morpholine (PubChem CID 90845057) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-(5-methylhexa-2,4-dien-3-yl)morpholine.
| Compound Name | 4-(5-methylhexa-2,4-dien-3-yl)morpholine |
|---|---|
| PubChem CID | 90845057 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-(5-methylhexa-2,4-dien-3-yl)morpholine |
| SMILES | CC=C(C=C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C11H19NO/c1-4-11(9-10(2)3)12-5-7-13-8-6-12/h4,9H,5-8H2,1-3H3 |
| InChIKey | XVECNMKEOSTDTM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|