C10H17NO — CID 90725635
4-hexa-2,4-dien-3-ylmorpholine (PubChem CID 90725635) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-hexa-2,4-dien-3-ylmorpholine.
| Compound Name | 4-hexa-2,4-dien-3-ylmorpholine |
|---|---|
| PubChem CID | 90725635 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-hexa-2,4-dien-3-ylmorpholine |
| SMILES | CC=CC(=CC)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO/c1-3-5-10(4-2)11-6-8-12-9-7-11/h3-5H,6-9H2,1-2H3 |
| InChIKey | DHBNIZQFEZSNHD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|