C12H20N2O — CID 88899217
(2Z,4E,6E)-7-morpholin-4-ylocta-2,4,6-trien-4-amine (PubChem CID 88899217) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (2Z,4E,6E)-7-morpholin-4-ylocta-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6E)-7-morpholin-4-ylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 88899217 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2Z,4E,6E)-7-morpholin-4-ylocta-2,4,6-trien-4-amine |
| SMILES | C/C=C\C(N)=C/C=C(\C)N1CCOCC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-4-12(13)6-5-11(2)14-7-9-15-10-8-14/h3-6H,7-10,13H2,1-2H3/b4-3-,11-5+,12-6+ |
| InChIKey | CFENXFYCODLFGM-KZHSBIRPSA-N |
| XLogP | 1.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|