C10H18N2O2 — CID 90131568
2-[[(3E,5E)-7-amino-6-methoxyhepta-1,3,5-trien-3-yl]amino]ethanol (PubChem CID 90131568) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-[[(3E,5E)-7-amino-6-methoxyhepta-1,3,5-trien-3-yl]amino]ethanol.
| Compound Name | 2-[[(3E,5E)-7-amino-6-methoxyhepta-1,3,5-trien-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 90131568 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-[[(3E,5E)-7-amino-6-methoxyhepta-1,3,5-trien-3-yl]amino]ethanol |
| SMILES | C=C/C(=C\C=C(/CN)OC)NCCO |
| InChI | InChI=1S/C10H18N2O2/c1-3-9(12-6-7-13)4-5-10(8-11)14-2/h3-5,12-13H,1,6-8,11H2,2H3/b9-4+,10-5+ |
| InChIKey | CCJHYIQGDUWKDW-LUZURFALSA-N |
| XLogP | 0.13 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|