C12H22N2O — CID 89153975
(2E,4E)-2-N-[(2R)-2-methoxypropyl]-2-N-methylhepta-2,4,6-triene-2,5-diamine (PubChem CID 89153975) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2E,4E)-2-N-[(2R)-2-methoxypropyl]-2-N-methylhepta-2,4,6-triene-2,5-diamine.
| Compound Name | (2E,4E)-2-N-[(2R)-2-methoxypropyl]-2-N-methylhepta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 89153975 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2E,4E)-2-N-[(2R)-2-methoxypropyl]-2-N-methylhepta-2,4,6-triene-2,5-diamine |
| SMILES | C=C/C(N)=C\C=C(/C)N(C)C[C@@H](C)OC |
| InChI | InChI=1S/C12H22N2O/c1-6-12(13)8-7-10(2)14(4)9-11(3)15-5/h6-8,11H,1,9,13H2,2-5H3/b10-7+,12-8+/t11-/m1/s1 |
| InChIKey | FHNGGZVZNXDQGJ-YVFXSWDWSA-N |
| XLogP | 1.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|