C13H22N2O — CID 89215091
(3E,5E)-6-(2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-3-amine (PubChem CID 89215091) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (3E,5E)-6-(2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-(2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89215091 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (3E,5E)-6-(2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C(/C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C13H22N2O/c1-5-13(14)7-6-10(2)15-8-11(3)16-12(4)9-15/h5-7,11-12H,1,8-9,14H2,2-4H3/b10-6+,13-7+ |
| InChIKey | NDDIIXTZLULIHH-OIGXVCCLSA-N |
| XLogP | 2.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|