C13H24N2O — CID 89073745
(2E,4Z)-6-[(2R,6S)-2,3,6-trimethylmorpholin-4-yl]hexa-2,4-dien-3-amine (PubChem CID 89073745) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (2E,4Z)-6-[(2R,6S)-2,3,6-trimethylmorpholin-4-yl]hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-6-[(2R,6S)-2,3,6-trimethylmorpholin-4-yl]hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 89073745 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (2E,4Z)-6-[(2R,6S)-2,3,6-trimethylmorpholin-4-yl]hexa-2,4-dien-3-amine |
| SMILES | C/C=C(N)\C=C/CN1C[C@H](C)O[C@H](C)C1C |
| InChI | InChI=1S/C13H24N2O/c1-5-13(14)7-6-8-15-9-10(2)16-12(4)11(15)3/h5-7,10-12H,8-9,14H2,1-4H3/b7-6-,13-5+/t10-,11?,12+/m0/s1 |
| InChIKey | JNUBIJYPMUHHLI-ZPEAUISZSA-N |
| XLogP | 1.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|