About 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine
4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 70892383) has the molecular formula C12H19FN2O
and a molecular weight of 226.29 g/mol. Its IUPAC name is 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 70892383 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC1CN(C2=CCC(N)C=C2)C(F)C(C)O1 |
| InChI | InChI=1S/C12H19FN2O/c1-8-7-15(12(13)9(2)16-8)11-5-3-10(14)4-6-11/h3,5-6,8-10,12H,4,7,14H2,1-2H3 |
| InChIKey | CNPPQZNIXIWRQO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine (CID 70892383) is 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine is CC1CN(C2=CCC(N)C=C2)C(F)C(C)O1.
What is the InChIKey of 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine?
The InChIKey is CNPPQZNIXIWRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2O/c1-8-7-15(12(13)9(2)16-8)11-5-3-10(14)4-6-11/h3,5-6,8-10,12H,4,7,14H2,1-2H3.
What are the key properties of 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine?
4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine has a molecular weight of 226.29 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 70892383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).