C11H16FNO — CID 170589843
N-[(2E,4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]oxetan-3-amine (PubChem CID 170589843) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is N-[(2E,4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]oxetan-3-amine.
| Compound Name | N-[(2E,4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]oxetan-3-amine |
|---|---|
| PubChem CID | 170589843 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[(2E,4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]oxetan-3-amine |
| SMILES | C/C=C(F)\C=C/C(=C\C)NC1COC1 |
| InChI | InChI=1S/C11H16FNO/c1-3-9(12)5-6-10(4-2)13-11-7-14-8-11/h3-6,11,13H,7-8H2,1-2H3/b6-5-,9-3+,10-4+ |
| InChIKey | ZCYOOLVCGAUYLM-RTTBPYAMSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|