C11H21NO — CID 123924894
N-(2-hexa-2,4-dien-2-yloxyethyl)propan-1-amine (PubChem CID 123924894) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is N-(2-hexa-2,4-dien-2-yloxyethyl)propan-1-amine.
| Compound Name | N-(2-hexa-2,4-dien-2-yloxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 123924894 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-(2-hexa-2,4-dien-2-yloxyethyl)propan-1-amine |
| SMILES | CC=CC=C(C)OCCNCCC |
| InChI | InChI=1S/C11H21NO/c1-4-6-7-11(3)13-10-9-12-8-5-2/h4,6-7,12H,5,8-10H2,1-3H3 |
| InChIKey | KCOOGZAOWWWWSJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|