C12H22FNO — CID 143503054
N-[2-[(2E,4E)-5-fluorohepta-2,4-dien-2-yl]oxyethyl]propan-1-amine (PubChem CID 143503054) has the molecular formula C12H22FNO and a molecular weight of 215.31 g/mol. Its IUPAC name is N-[2-[(2E,4E)-5-fluorohepta-2,4-dien-2-yl]oxyethyl]propan-1-amine.
| Compound Name | N-[2-[(2E,4E)-5-fluorohepta-2,4-dien-2-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 143503054 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-[2-[(2E,4E)-5-fluorohepta-2,4-dien-2-yl]oxyethyl]propan-1-amine |
| SMILES | CCCNCCO/C(C)=C/C=C(/F)CC |
| InChI | InChI=1S/C12H22FNO/c1-4-8-14-9-10-15-11(3)6-7-12(13)5-2/h6-7,14H,4-5,8-10H2,1-3H3/b11-6+,12-7+ |
| InChIKey | LREVHEKQJRURKA-GNXRPPCSSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|