C13H23NO — CID 156637556
ethane;7-methyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydro-1,4-oxazepine (PubChem CID 156637556) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;7-methyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydro-1,4-oxazepine.
| Compound Name | ethane;7-methyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydro-1,4-oxazepine |
|---|---|
| PubChem CID | 156637556 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;7-methyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydro-1,4-oxazepine |
| SMILES | C=C/C(C)=C\C1=C(C)OCCNC1.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-4-9(2)7-11-8-12-5-6-13-10(11)3;1-2/h4,7,12H,1,5-6,8H2,2-3H3;1-2H3/b9-7-; |
| InChIKey | SLDPKLVDHOMEOR-VILQZVERSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|