C10H18FNO — CID 137438950
(2E)-N-(2-ethoxypropyl)-2-fluoropenta-2,4-dien-1-amine (PubChem CID 137438950) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (2E)-N-(2-ethoxypropyl)-2-fluoropenta-2,4-dien-1-amine.
| Compound Name | (2E)-N-(2-ethoxypropyl)-2-fluoropenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 137438950 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2E)-N-(2-ethoxypropyl)-2-fluoropenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/F)CNCC(C)OCC |
| InChI | InChI=1S/C10H18FNO/c1-4-6-10(11)8-12-7-9(3)13-5-2/h4,6,9,12H,1,5,7-8H2,2-3H3/b10-6+ |
| InChIKey | NCVLGSZUUDKMPN-UXBLZVDNSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|