C8H15NO — CID 123747746
N-methyl-2-penta-2,4-dien-2-yloxyethanamine (PubChem CID 123747746) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is N-methyl-2-penta-2,4-dien-2-yloxyethanamine.
| Compound Name | N-methyl-2-penta-2,4-dien-2-yloxyethanamine |
|---|---|
| PubChem CID | 123747746 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-methyl-2-penta-2,4-dien-2-yloxyethanamine |
| SMILES | C=CC=C(C)OCCNC |
| InChI | InChI=1S/C8H15NO/c1-4-5-8(2)10-7-6-9-3/h4-5,9H,1,6-7H2,2-3H3 |
| InChIKey | WTWRWLMGMLZGAP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|