C9H14FNO — CID 178010057
2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]-N-methylethanamine (PubChem CID 178010057) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is 2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]-N-methylethanamine.
| Compound Name | 2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 178010057 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]-N-methylethanamine |
| SMILES | C=C/C(F)=C\C=C\OCCNC |
| InChI | InChI=1S/C9H14FNO/c1-3-9(10)5-4-7-12-8-6-11-2/h3-5,7,11H,1,6,8H2,2H3/b7-4+,9-5+ |
| InChIKey | GNGSQAQQSQYCIY-XCIOYXGDSA-N |
| XLogP | 1.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|