C9H15NO — CID 143143858
2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine (PubChem CID 143143858) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 143143858 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine |
| SMILES | C=C/C=C(\C=C)OCCNC |
| InChI | InChI=1S/C9H15NO/c1-4-6-9(5-2)11-8-7-10-3/h4-6,10H,1-2,7-8H2,3H3/b9-6+ |
| InChIKey | AIKDLFDURKCJEH-RMKNXTFCSA-N |
| XLogP | 1.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|