C8H14FNO — CID 172599685
N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine (PubChem CID 172599685) has the molecular formula C8H14FNO and a molecular weight of 159.20 g/mol. Its IUPAC name is N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine.
| Compound Name | N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 172599685 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
| SMILES | C=C/C(=C\C)OCCN(C)F |
| InChI | InChI=1S/C8H14FNO/c1-4-8(5-2)11-7-6-10(3)9/h4-5H,1,6-7H2,2-3H3/b8-5+ |
| InChIKey | YTQIMRYUUYJPBE-VMPITWQZSA-N |
| XLogP | 1.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|