C10H17NO — CID 123967594
2-hexa-1,3,5-trien-2-yloxy-N,N-dimethylethanamine (PubChem CID 123967594) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-hexa-1,3,5-trien-2-yloxy-N,N-dimethylethanamine.
| Compound Name | 2-hexa-1,3,5-trien-2-yloxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 123967594 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-hexa-1,3,5-trien-2-yloxy-N,N-dimethylethanamine |
| SMILES | C=CC=CC(=C)OCCN(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-6-7-10(2)12-9-8-11(3)4/h5-7H,1-2,8-9H2,3-4H3 |
| InChIKey | NFFJQCRMXMPDAY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|