C9H17NO — CID 143143857
2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine;molecular hydrogen (PubChem CID 143143857) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine;molecular hydrogen.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine;molecular hydrogen |
|---|---|
| PubChem CID | 143143857 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxy-N-methylethanamine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)OCCNC.[H][H] |
| InChI | InChI=1S/C9H15NO.H2/c1-4-6-9(5-2)11-8-7-10-3;/h4-6,10H,1-2,7-8H2,3H3;1H/b9-6+; |
| InChIKey | POKYUIZQDFYCIR-MLBSPLJJSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|