C7H13NO — CID 138730039
2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine (PubChem CID 138730039) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine.
| Compound Name | 2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 138730039 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
| SMILES | C=C/C(=C\C)OCCN |
| InChI | InChI=1S/C7H13NO/c1-3-7(4-2)9-6-5-8/h3-4H,1,5-6,8H2,2H3/b7-4+ |
| InChIKey | OIMSRNZGHLBACG-QPJJXVBHSA-N |
| XLogP | 1.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|