C11H18N2O — CID 126584068
(2E)-N-ethenyl-4-morpholin-4-ylpenta-2,4-dien-2-amine (PubChem CID 126584068) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (2E)-N-ethenyl-4-morpholin-4-ylpenta-2,4-dien-2-amine.
| Compound Name | (2E)-N-ethenyl-4-morpholin-4-ylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 126584068 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2E)-N-ethenyl-4-morpholin-4-ylpenta-2,4-dien-2-amine |
| SMILES | C=CN/C(C)=C/C(=C)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-4-12-10(2)9-11(3)13-5-7-14-8-6-13/h4,9,12H,1,3,5-8H2,2H3/b10-9+ |
| InChIKey | VRGYXPBURUQCIQ-MDZDMXLPSA-N |
| XLogP | 1.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|