C10H15NO — CID 144557216
5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine (PubChem CID 144557216) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine.
| Compound Name | 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 144557216 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine |
| SMILES | C=CC1=C(C=C)N(CC)CCO1 |
| InChI | InChI=1S/C10H15NO/c1-4-9-10(5-2)12-8-7-11(9)6-3/h4-5H,1-2,6-8H2,3H3 |
| InChIKey | SNTRHLBDAAPBKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |