C8H11NO3 — CID 118400703
3-[(E)-4-oxopent-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 118400703) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-[(E)-4-oxopent-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-4-oxopent-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118400703 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-[(E)-4-oxopent-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | CC(=O)/C=C/CN1CCOC1=O |
| InChI | InChI=1S/C8H11NO3/c1-7(10)3-2-4-9-5-6-12-8(9)11/h2-3H,4-6H2,1H3/b3-2+ |
| InChIKey | ACPMTDIEHHOSTN-NSCUHMNNSA-N |
| XLogP | 0.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|