About 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride
3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 141105157) has the molecular formula C4H9ClN2O2
and a molecular weight of 152.58 g/mol. Its IUPAC name is 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride.
Analyze 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The IUPAC name of 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride (CID 141105157) is 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride.
What is the SMILES notation for 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The canonical SMILES for 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride is Cl.NCN1CCOC1=O.
What is the InChIKey of 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
The InChIKey is VORZXXXBQGNBKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.ClH/c5-3-6-1-2-8-4(6)7;/h1-3,5H2;1H.
What are the key properties of 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride?
3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride has a molecular weight of 152.58 g/mol, XLogP of -0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-1,3-oxazolidin-2-one;hydrochloride is sourced from PubChem (CID 141105157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).