C7H14N2O3 — CID 107506091
3-(2-amino-3-methoxypropyl)-1,3-oxazolidin-2-one (PubChem CID 107506091) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(2-amino-3-methoxypropyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-amino-3-methoxypropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 107506091 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-(2-amino-3-methoxypropyl)-1,3-oxazolidin-2-one |
| SMILES | COCC(N)CN1CCOC1=O |
| InChI | InChI=1S/C7H14N2O3/c1-11-5-6(8)4-9-2-3-12-7(9)10/h6H,2-5,8H2,1H3 |
| InChIKey | BNAMNENEFWRZCG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |