C11H21NO2 — CID 3565999
3-octyl-1,3-oxazolidin-2-one (PubChem CID 3565999) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-octyl-1,3-oxazolidin-2-one.
| Compound Name | 3-octyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3565999 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-octyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCN1CCOC1=O |
| InChI | InChI=1S/C11H21NO2/c1-2-3-4-5-6-7-8-12-9-10-14-11(12)13/h2-10H2,1H3 |
| InChIKey | SQKJDGQQIAFTAQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|