C20H38N2O4 — CID 541282
7,10-dihexyl-1,4-dioxa-7,10-diazacyclododecane-6,11-dione (PubChem CID 541282) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 7,10-dihexyl-1,4-dioxa-7,10-diazacyclododecane-6,11-dione.
| Compound Name | 7,10-dihexyl-1,4-dioxa-7,10-diazacyclododecane-6,11-dione |
|---|---|
| PubChem CID | 541282 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 7,10-dihexyl-1,4-dioxa-7,10-diazacyclododecane-6,11-dione |
| SMILES | CCCCCCN1CCN(CCCCCC)C(=O)COCCOCC1=O |
| InChI | InChI=1S/C20H38N2O4/c1-3-5-7-9-11-21-13-14-22(12-10-8-6-4-2)20(24)18-26-16-15-25-17-19(21)23/h3-18H2,1-2H3 |
| InChIKey | OJXKDBZPQGBNRV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|