C7H13NO2S — CID 130297937
3-(2-ethylsulfanylethyl)-1,3-oxazolidin-2-one (PubChem CID 130297937) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-ethylsulfanylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130297937 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-1,3-oxazolidin-2-one |
| SMILES | CCSCCN1CCOC1=O |
| InChI | InChI=1S/C7H13NO2S/c1-2-11-6-4-8-3-5-10-7(8)9/h2-6H2,1H3 |
| InChIKey | JQJHQIQOMIDPIR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|