C7H14N2O2 — CID 61350941
3-[3-(methylamino)propyl]-1,3-oxazolidin-2-one (PubChem CID 61350941) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-[3-(methylamino)propyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(methylamino)propyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 61350941 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3-[3-(methylamino)propyl]-1,3-oxazolidin-2-one |
| SMILES | CNCCCN1CCOC1=O |
| InChI | InChI=1S/C7H14N2O2/c1-8-3-2-4-9-5-6-11-7(9)10/h8H,2-6H2,1H3 |
| InChIKey | MIPNVRSJBXUAIF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|