C7H15N2O2+ — CID 73349591
trimethyl-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium (PubChem CID 73349591) has the molecular formula C7H15N2O2+ and a molecular weight of 159.21 g/mol. Its IUPAC name is trimethyl-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium.
| Compound Name | trimethyl-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium |
|---|---|
| PubChem CID | 73349591 |
| Molecular Formula | C7H15N2O2+ |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | trimethyl-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium |
| SMILES | C[N+](C)(C)C[C@@H]1CNC(=O)O1 |
| InChI | InChI=1S/C7H14N2O2/c1-9(2,3)5-6-4-8-7(10)11-6/h6H,4-5H2,1-3H3/p+1/t6-/m0/s1 |
| InChIKey | OKUHBVWVMMKCTK-LURJTMIESA-O |
| XLogP | -0.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|