C16H31NO2 — CID 151323535
3-(10,10-dimethylundecyl)-1,3-oxazolidin-2-one (PubChem CID 151323535) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 3-(10,10-dimethylundecyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(10,10-dimethylundecyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 151323535 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 3-(10,10-dimethylundecyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)CCCCCCCCCN1CCOC1=O |
| InChI | InChI=1S/C16H31NO2/c1-16(2,3)11-9-7-5-4-6-8-10-12-17-13-14-19-15(17)18/h4-14H2,1-3H3 |
| InChIKey | OGYQJHTWVBCHDH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|