C10H19N3O3 — CID 110747891
1-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-3-propylurea (PubChem CID 110747891) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-3-propylurea.
| Compound Name | 1-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-3-propylurea |
|---|---|
| PubChem CID | 110747891 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-[3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-3-propylurea |
| SMILES | CCCNC(=O)NCCCN1CCOC1=O |
| InChI | InChI=1S/C10H19N3O3/c1-2-4-11-9(14)12-5-3-6-13-7-8-16-10(13)15/h2-8H2,1H3,(H2,11,12,14) |
| InChIKey | KPEAAWZFYBYPQK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|