C7H11NO5 — CID 107836616
2-hydroxy-4-(2-oxo-1,3-oxazolidin-3-yl)butanoic acid (PubChem CID 107836616) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-hydroxy-4-(2-oxo-1,3-oxazolidin-3-yl)butanoic acid.
| Compound Name | 2-hydroxy-4-(2-oxo-1,3-oxazolidin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 107836616 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-hydroxy-4-(2-oxo-1,3-oxazolidin-3-yl)butanoic acid |
| SMILES | O=C(O)C(O)CCN1CCOC1=O |
| InChI | InChI=1S/C7H11NO5/c9-5(6(10)11)1-2-8-3-4-13-7(8)12/h5,9H,1-4H2,(H,10,11) |
| InChIKey | FVHRHKIERFDXDY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |