C9H15NO — CID 91562621
2,3-di(ethylidene)-4-methylmorpholine (PubChem CID 91562621) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,3-di(ethylidene)-4-methylmorpholine.
| Compound Name | 2,3-di(ethylidene)-4-methylmorpholine |
|---|---|
| PubChem CID | 91562621 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,3-di(ethylidene)-4-methylmorpholine |
| SMILES | CC=C1OCCN(C)C1=CC |
| InChI | InChI=1S/C9H15NO/c1-4-8-9(5-2)11-7-6-10(8)3/h4-5H,6-7H2,1-3H3 |
| InChIKey | IMAWQXBSWYJRAX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |