C18H19N — CID 143127917
9-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,4,9-tetrahydro-1H-indeno[2,1-c]pyridine (PubChem CID 143127917) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 9-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,4,9-tetrahydro-1H-indeno[2,1-c]pyridine.
| Compound Name | 9-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,4,9-tetrahydro-1H-indeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 143127917 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 9-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,4,9-tetrahydro-1H-indeno[2,1-c]pyridine |
| SMILES | C=C/C=C(\C=C)C1C2=C(CCNC2)c2ccccc21 |
| InChI | InChI=1S/C18H19N/c1-3-7-13(4-2)18-16-9-6-5-8-14(16)15-10-11-19-12-17(15)18/h3-9,18-19H,1-2,10-12H2/b13-7+ |
| InChIKey | FXYFRNIPSZMBOB-NTUHNPAUSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|