C19H17N — CID 12556925
4-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),9,11,13,15,17,19-heptaene (PubChem CID 12556925) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),9,11,13,15,17,19-heptaene.
| Compound Name | 4-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),9,11,13,15,17,19-heptaene |
|---|---|
| PubChem CID | 12556925 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),9,11,13,15,17,19-heptaene |
| SMILES | c1ccc2c(c1)C1C3=C(CNCC3)C2c2ccccc21 |
| InChI | InChI=1S/C19H17N/c1-3-7-14-12(5-1)18-13-6-2-4-8-15(13)19(14)17-11-20-10-9-16(17)18/h1-8,18-20H,9-11H2 |
| InChIKey | CCEPEZMQSFUHFN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|