C17H25NO — CID 166874467
(2E,4E)-5-cyclooctyl-2-ethenylhepta-2,4,6-trienamide (PubChem CID 166874467) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (2E,4E)-5-cyclooctyl-2-ethenylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-cyclooctyl-2-ethenylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 166874467 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2E,4E)-5-cyclooctyl-2-ethenylhepta-2,4,6-trienamide |
| SMILES | C=C/C(=C\C=C(/C=C)C(N)=O)C1CCCCCCC1 |
| InChI | InChI=1S/C17H25NO/c1-3-14(12-13-15(4-2)17(18)19)16-10-8-6-5-7-9-11-16/h3-4,12-13,16H,1-2,5-11H2,(H2,18,19)/b14-12+,15-13+ |
| InChIKey | CKBYKDXFTLNLNM-QUMQEAAQSA-N |
| XLogP | 4.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|