C20H32N2 — CID 138483418
N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide (PubChem CID 138483418) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide.
| Compound Name | N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide |
|---|---|
| PubChem CID | 138483418 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide |
| SMILES | C=CC(=C\C)/C(=C\C)/N=C(\N=C(C)C)C1CCCCCCC1 |
| InChI | InChI=1S/C20H32N2/c1-6-17(7-2)19(8-3)22-20(21-16(4)5)18-14-12-10-9-11-13-15-18/h6-8,18H,1,9-15H2,2-5H3/b17-7+,19-8+,22-20- |
| InChIKey | GSSDIGOICIHPGX-TWAQELKWSA-N |
| XLogP | 6.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|