About N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide
N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide (PubChem CID 138483418) has the molecular formula C20H32N2
and a molecular weight of 300.49 g/mol. Its IUPAC name is N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide.
Molecular Properties
| Compound Name | N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide |
| PubChem CID | 138483418 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide |
| SMILES | C=CC(=C\C)/C(=C\C)/N=C(\N=C(C)C)C1CCCCCCC1 |
| InChI | InChI=1S/C20H32N2/c1-6-17(7-2)19(8-3)22-20(21-16(4)5)18-14-12-10-9-11-13-15-18/h6-8,18H,1,9-15H2,2-5H3/b17-7+,19-8+,22-20- |
| InChIKey | GSSDIGOICIHPGX-TWAQELKWSA-N |
| XLogP | 6.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide?
The IUPAC name of N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide (CID 138483418) is N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide.
What is the SMILES notation for N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide?
The canonical SMILES for N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide is C=CC(=C\C)/C(=C\C)/N=C(\N=C(C)C)C1CCCCCCC1.
What is the InChIKey of N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide?
The InChIKey is GSSDIGOICIHPGX-TWAQELKWSA-N. The full InChI is InChI=1S/C20H32N2/c1-6-17(7-2)19(8-3)22-20(21-16(4)5)18-14-12-10-9-11-13-15-18/h6-8,18H,1,9-15H2,2-5H3/b17-7+,19-8+,22-20-.
What are the key properties of N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide?
N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide has a molecular weight of 300.49 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2E,4E)-4-ethenylhexa-2,4-dien-3-yl]-N-propan-2-ylidenecyclooctanecarboximidamide is sourced from PubChem (CID 138483418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).