C13H22 — CID 144579674
[(3E)-penta-1,3-dien-3-yl]cyclopentane;prop-1-ene (PubChem CID 144579674) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is [(3E)-penta-1,3-dien-3-yl]cyclopentane;prop-1-ene.
| Compound Name | [(3E)-penta-1,3-dien-3-yl]cyclopentane;prop-1-ene |
|---|---|
| PubChem CID | 144579674 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | [(3E)-penta-1,3-dien-3-yl]cyclopentane;prop-1-ene |
| SMILES | C=C/C(=C\C)C1CCCC1.C=CC |
| InChI | InChI=1S/C10H16.C3H6/c1-3-9(4-2)10-7-5-6-8-10;1-3-2/h3-4,10H,1,5-8H2,2H3;3H,1H2,2H3/b9-4+; |
| InChIKey | XXESGXPGWFYUCV-JOKMOOFLSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|