C11H26N2O — CID 156650142
ethane;methanamine;(2S)-2-[(3E)-penta-1,3-dien-3-yl]oxirane (PubChem CID 156650142) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;methanamine;(2S)-2-[(3E)-penta-1,3-dien-3-yl]oxirane.
| Compound Name | ethane;methanamine;(2S)-2-[(3E)-penta-1,3-dien-3-yl]oxirane |
|---|---|
| PubChem CID | 156650142 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | ethane;methanamine;(2S)-2-[(3E)-penta-1,3-dien-3-yl]oxirane |
| SMILES | C=C/C(=C\C)[C@H]1CO1.CC.CN.CN |
| InChI | InChI=1S/C7H10O.C2H6.2CH5N/c1-3-6(4-2)7-5-8-7;3*1-2/h3-4,7H,1,5H2,2H3;1-2H3;2*2H2,1H3/b6-4+;;;/t7-;;;/m1.../s1 |
| InChIKey | HUTHODYZGZMLLL-AIZRRRKMSA-N |
| XLogP | 1.69 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|