C11H20O — CID 144532117
ethane;ethene;2-[(3Z)-penta-1,3-dien-2-yl]oxirane (PubChem CID 144532117) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;ethene;2-[(3Z)-penta-1,3-dien-2-yl]oxirane.
| Compound Name | ethane;ethene;2-[(3Z)-penta-1,3-dien-2-yl]oxirane |
|---|---|
| PubChem CID | 144532117 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | ethane;ethene;2-[(3Z)-penta-1,3-dien-2-yl]oxirane |
| SMILES | C=C.C=C(/C=C\C)C1CO1.CC |
| InChI | InChI=1S/C7H10O.C2H6.C2H4/c1-3-4-6(2)7-5-8-7;2*1-2/h3-4,7H,2,5H2,1H3;1-2H3;1-2H2/b4-3-;; |
| InChIKey | RVRDIDKZRRULHL-GSBNXNDCSA-N |
| XLogP | 3.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|