C7H10O — CID 172817601
2-(3-methylbuta-1,3-dienyl)oxirane (PubChem CID 172817601) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is 2-(3-methylbuta-1,3-dienyl)oxirane.
| Compound Name | 2-(3-methylbuta-1,3-dienyl)oxirane |
|---|---|
| PubChem CID | 172817601 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 2-(3-methylbuta-1,3-dienyl)oxirane |
| SMILES | C=C(C)C=CC1CO1 |
| InChI | InChI=1S/C7H10O/c1-6(2)3-4-7-5-8-7/h3-4,7H,1,5H2,2H3 |
| InChIKey | TTZNODLREVBTBB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|