About cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide
cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide (PubChem CID 67573773) has the molecular formula C36H63NO4
and a molecular weight of 573.90 g/mol. Its IUPAC name is cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide.
Molecular Properties
| Compound Name | cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide |
| PubChem CID | 67573773 |
| Molecular Formula | C36H63NO4 |
| Molecular Weight | 573.90 g/mol |
| Exact Mass | 573.48 |
| IUPAC Name | cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C(OC1CCCCCCCCC1)C(O)=C(C1CCCCCCCCC1)C1CCCCCCCCC1 |
| InChI | InChI=1S/C33H58O3.C3H5NO/c34-32(33(35)36-30-26-20-14-8-3-9-15-21-27-30)31(28-22-16-10-4-1-5-11-17-23-28)29-24-18-12-6-2-7-13-19-25-29;1-2-3(4)5/h28-30,34H,1-27H2;2H,1H2,(H2,4,5) |
| InChIKey | SGECQQHKGJLACS-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.90 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide?
The IUPAC name of cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide (CID 67573773) is cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide.
What is the SMILES notation for cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide?
The canonical SMILES for cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide is C=CC(N)=O.O=C(OC1CCCCCCCCC1)C(O)=C(C1CCCCCCCCC1)C1CCCCCCCCC1.
What is the InChIKey of cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide?
The InChIKey is SGECQQHKGJLACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H58O3.C3H5NO/c34-32(33(35)36-30-26-20-14-8-3-9-15-21-27-30)31(28-22-16-10-4-1-5-11-17-23-28)29-24-18-12-6-2-7-13-19-25-29;1-2-3(4)5/h28-30,34H,1-27H2;2H,1H2,(H2,4,5).
What are the key properties of cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide?
cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide has a molecular weight of 573.90 g/mol, XLogP of 10.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclodecyl 3,3-di(cyclodecyl)-2-hydroxyprop-2-enoate;prop-2-enamide is sourced from PubChem (CID 67573773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).