About cyclohexyl 2-hydroxybut-2-enoate
cyclohexyl 2-hydroxybut-2-enoate (PubChem CID 141455466) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is cyclohexyl 2-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | cyclohexyl 2-hydroxybut-2-enoate |
| PubChem CID | 141455466 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | cyclohexyl 2-hydroxybut-2-enoate |
| SMILES | CC=C(O)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H16O3/c1-2-9(11)10(12)13-8-6-4-3-5-7-8/h2,8,11H,3-7H2,1H3 |
| InChIKey | MLXMICAFCGVNFO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-hydroxybut-2-enoate?
The IUPAC name of cyclohexyl 2-hydroxybut-2-enoate (CID 141455466) is cyclohexyl 2-hydroxybut-2-enoate.
What is the SMILES notation for cyclohexyl 2-hydroxybut-2-enoate?
The canonical SMILES for cyclohexyl 2-hydroxybut-2-enoate is CC=C(O)C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-hydroxybut-2-enoate?
The InChIKey is MLXMICAFCGVNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-9(11)10(12)13-8-6-4-3-5-7-8/h2,8,11H,3-7H2,1H3.
What are the key properties of cyclohexyl 2-hydroxybut-2-enoate?
cyclohexyl 2-hydroxybut-2-enoate has a molecular weight of 184.24 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-hydroxybut-2-enoate is sourced from PubChem (CID 141455466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).