C19H39N — CID 143178323
ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,4-dimethylpiperidine (PubChem CID 143178323) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,4-dimethylpiperidine.
| Compound Name | ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,4-dimethylpiperidine |
|---|---|
| PubChem CID | 143178323 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,4-dimethylpiperidine |
| SMILES | C=C/C=C(\C=C)C1CNC(C)CC1C.CC.CC.CC |
| InChI | InChI=1S/C13H21N.3C2H6/c1-5-7-12(6-2)13-9-14-11(4)8-10(13)3;3*1-2/h5-7,10-11,13-14H,1-2,8-9H2,3-4H3;3*1-2H3/b12-7+;;; |
| InChIKey | UBDSPTYHHOHARV-OKDQOLBWSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|