C22H37Cl — CID 129130549
1-[4-[(3E,5E)-6-chlorohepta-3,5-dien-3-yl]cyclohexyl]-4-ethylcycloheptane (PubChem CID 129130549) has the molecular formula C22H37Cl and a molecular weight of 336.99 g/mol. Its IUPAC name is 1-[4-[(3E,5E)-6-chlorohepta-3,5-dien-3-yl]cyclohexyl]-4-ethylcycloheptane.
| Compound Name | 1-[4-[(3E,5E)-6-chlorohepta-3,5-dien-3-yl]cyclohexyl]-4-ethylcycloheptane |
|---|---|
| PubChem CID | 129130549 |
| Molecular Formula | C22H37Cl |
| Molecular Weight | 336.99 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-[4-[(3E,5E)-6-chlorohepta-3,5-dien-3-yl]cyclohexyl]-4-ethylcycloheptane |
| SMILES | CC/C(=C\C=C(/C)Cl)C1CCC(C2CCCC(CC)CC2)CC1 |
| InChI | InChI=1S/C22H37Cl/c1-4-18-7-6-8-20(12-10-18)22-15-13-21(14-16-22)19(5-2)11-9-17(3)23/h9,11,18,20-22H,4-8,10,12-16H2,1-3H3/b17-9+,19-11+ |
| InChIKey | HGHQQLCYUCBXDR-HRRFGWGBSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.99 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|