C19H32O — CID 114975947
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-ethylcyclohexyl)methanone (PubChem CID 114975947) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-ethylcyclohexyl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975947 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(4-ethylcyclohexyl)methanone |
| SMILES | CCC1CCC(C(=O)C2CCC3CCCCC3C2)CC1 |
| InChI | InChI=1S/C19H32O/c1-2-14-7-9-16(10-8-14)19(20)18-12-11-15-5-3-4-6-17(15)13-18/h14-18H,2-13H2,1H3 |
| InChIKey | GKKRGKQSZFZYAQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |