C16H28O — CID 107891225
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpentan-1-one (PubChem CID 107891225) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpentan-1-one.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpentan-1-one |
|---|---|
| PubChem CID | 107891225 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpentan-1-one |
| SMILES | CCCC(C)C(=O)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H28O/c1-3-6-12(2)16(17)15-10-9-13-7-4-5-8-14(13)11-15/h12-15H,3-11H2,1-2H3 |
| InChIKey | JTBTZTROUXFQCA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |