C22H40O2 — CID 145196204
ethylcyclohexane;4-(4-methylcyclohexyl)cyclohexane-1-carboxylic acid (PubChem CID 145196204) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is ethylcyclohexane;4-(4-methylcyclohexyl)cyclohexane-1-carboxylic acid.
| Compound Name | ethylcyclohexane;4-(4-methylcyclohexyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145196204 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | ethylcyclohexane;4-(4-methylcyclohexyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(C2CCC(C(=O)O)CC2)CC1.CCC1CCCCC1 |
| InChI | InChI=1S/C14H24O2.C8H16/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16;1-2-8-6-4-3-5-7-8/h10-13H,2-9H2,1H3,(H,15,16);8H,2-7H2,1H3 |
| InChIKey | APMUVDHIGHTCAG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |